C20H35NO8Si — CID 54706752
tert-butyl N-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxypropan-2-yl]carbamate (PubChem CID 54706752) has the molecular formula C20H35NO8Si and a molecular weight of 445.59 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54706752 |
| Molecular Formula | C20H35NO8Si |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | tert-butyl N-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO[Si](C)(C)C(C)(C)C)C(O)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C20H35NO8Si/c1-18(2,3)29-17(25)21-12(11-26-30(9,10)19(4,5)6)14(22)13-15(23)27-20(7,8)28-16(13)24/h12,22H,11H2,1-10H3,(H,21,25)/t12-/m1/s1 |
| InChIKey | SECWWSXOAZAYEZ-GFCCVEGCSA-N |
| XLogP | 3.55 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|