C20H41NO4Si — CID 11523916
tert-butyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxononan-2-yl]carbamate (PubChem CID 11523916) has the molecular formula C20H41NO4Si and a molecular weight of 387.64 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxononan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxononan-2-yl]carbamate |
|---|---|
| PubChem CID | 11523916 |
| Molecular Formula | C20H41NO4Si |
| Molecular Weight | 387.64 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | tert-butyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-oxononan-2-yl]carbamate |
| SMILES | CCCCCCC(=O)[C@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H41NO4Si/c1-10-11-12-13-14-17(22)16(21-18(23)25-19(2,3)4)15-24-26(8,9)20(5,6)7/h16H,10-15H2,1-9H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | VYKWTXXFJMWEFI-INIZCTEOSA-N |
| XLogP | 5.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|