C21H41NO6Si — CID 11633393
(2S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxodecanoic acid (PubChem CID 11633393) has the molecular formula C21H41NO6Si and a molecular weight of 431.65 g/mol. Its IUPAC name is (2S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxodecanoic acid.
| Compound Name | (2S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxodecanoic acid |
|---|---|
| PubChem CID | 11633393 |
| Molecular Formula | C21H41NO6Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | (2S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxodecanoic acid |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C21H41NO6Si/c1-15(28-29(8,9)21(5,6)7)17(23)14-12-10-11-13-16(18(24)25)22-19(26)27-20(2,3)4/h15-16H,10-14H2,1-9H3,(H,22,26)(H,24,25)/t15-,16+/m1/s1 |
| InChIKey | VDOXZRCXEGZFCH-CVEARBPZSA-N |
| XLogP | 4.89 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|