C41H79N3O11 — CID 159899433
tert-butyl (2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;tert-butyl (2S)-9-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxoundecanoate;2-methylbutanoic acid (PubChem CID 159899433) has the molecular formula C41H79N3O11 and a molecular weight of 790.09 g/mol. Its IUPAC name is tert-butyl (2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;tert-butyl (2S)-9-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxoundecanoate;2-methylbutanoic acid.
| Compound Name | tert-butyl (2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;tert-butyl (2S)-9-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxoundecanoate;2-methylbutanoic acid |
|---|---|
| PubChem CID | 159899433 |
| Molecular Formula | C41H79N3O11 |
| Molecular Weight | 790.09 g/mol |
| Exact Mass | 789.57 |
| IUPAC Name | tert-butyl (2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;tert-butyl (2S)-9-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxoundecanoate;2-methylbutanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCN)C(=O)OC(C)(C)C.CCC(C)C(=O)CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C.CCC(C)C(=O)O |
| InChI | InChI=1S/C21H39NO5.C15H30N2O4.C5H10O2/c1-9-15(2)17(23)14-12-10-11-13-16(18(24)26-20(3,4)5)22-19(25)27-21(6,7)8;1-14(2,3)20-12(18)11(9-7-8-10-16)17-13(19)21-15(4,5)6;1-3-4(2)5(6)7/h15-16H,9-14H2,1-8H3,(H,22,25);11H,7-10,16H2,1-6H3,(H,17,19);4H,3H2,1-2H3,(H,6,7)/t15?,16-;11-;/m00./s1 |
| InChIKey | NVTNLCGNRAPWKO-OSONTZCOSA-N |
| XLogP | 8.25 |
| TPSA | 209.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.09 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|