C16H31N3O5 — CID 88772976
2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]pentanoic acid (PubChem CID 88772976) has the molecular formula C16H31N3O5 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]pentanoic acid.
| Compound Name | 2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 88772976 |
| Molecular Formula | C16H31N3O5 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)[C@H](CCCCN)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H31N3O5/c1-5-8-12(14(21)22)18-13(20)11(9-6-7-10-17)19-15(23)24-16(2,3)4/h11-12H,5-10,17H2,1-4H3,(H,18,20)(H,19,23)(H,21,22)/t11-,12?/m0/s1 |
| InChIKey | ACMPALSTKBJZBZ-PXYINDEMSA-N |
| XLogP | 1.38 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|