C19H31NO4 — CID 19933959
tert-butyl N-[10-(furan-2-yl)-6-oxodecan-5-yl]carbamate (PubChem CID 19933959) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl N-[10-(furan-2-yl)-6-oxodecan-5-yl]carbamate.
| Compound Name | tert-butyl N-[10-(furan-2-yl)-6-oxodecan-5-yl]carbamate |
|---|---|
| PubChem CID | 19933959 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | tert-butyl N-[10-(furan-2-yl)-6-oxodecan-5-yl]carbamate |
| SMILES | CCCCC(NC(=O)OC(C)(C)C)C(=O)CCCCc1ccco1 |
| InChI | InChI=1S/C19H31NO4/c1-5-6-12-16(20-18(22)24-19(2,3)4)17(21)13-8-7-10-15-11-9-14-23-15/h9,11,14,16H,5-8,10,12-13H2,1-4H3,(H,20,22) |
| InChIKey | XHUGMRDMYFAVAL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|