C21H27NO4S — CID 54324420
tert-butyl N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxo-5-phenylpentan-3-yl]carbamate (PubChem CID 54324420) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxo-5-phenylpentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxo-5-phenylpentan-3-yl]carbamate |
|---|---|
| PubChem CID | 54324420 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | tert-butyl N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxo-5-phenylpentan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCc1ccccc1)C(=O)CSCc1ccco1 |
| InChI | InChI=1S/C21H27NO4S/c1-21(2,3)26-20(24)22-18(12-11-16-8-5-4-6-9-16)19(23)15-27-14-17-10-7-13-25-17/h4-10,13,18H,11-12,14-15H2,1-3H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | STXCIXSRBYOLSB-SFHVURJKSA-N |
| XLogP | 4.61 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |