C20H25NO4S — CID 15287855
N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxoheptan-3-yl]-2-phenoxyacetamide (PubChem CID 15287855) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxoheptan-3-yl]-2-phenoxyacetamide.
| Compound Name | N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxoheptan-3-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 15287855 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxoheptan-3-yl]-2-phenoxyacetamide |
| SMILES | CCCC[C@H](NC(=O)COc1ccccc1)C(=O)CSCc1ccco1 |
| InChI | InChI=1S/C20H25NO4S/c1-2-3-11-18(19(22)15-26-14-17-10-7-12-24-17)21-20(23)13-25-16-8-5-4-6-9-16/h4-10,12,18H,2-3,11,13-15H2,1H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | ADTWASIKXTXLGG-SFHVURJKSA-N |
| XLogP | 3.84 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |