C25H27NO4S — CID 70059729
N-[(2S)-4-(furan-2-ylmethylsulfanyl)-3-oxo-1-phenylbutan-2-yl]-2-phenoxybutanamide (PubChem CID 70059729) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is N-[(2S)-4-(furan-2-ylmethylsulfanyl)-3-oxo-1-phenylbutan-2-yl]-2-phenoxybutanamide.
| Compound Name | N-[(2S)-4-(furan-2-ylmethylsulfanyl)-3-oxo-1-phenylbutan-2-yl]-2-phenoxybutanamide |
|---|---|
| PubChem CID | 70059729 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[(2S)-4-(furan-2-ylmethylsulfanyl)-3-oxo-1-phenylbutan-2-yl]-2-phenoxybutanamide |
| SMILES | CCC(Oc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)CSCc1ccco1 |
| InChI | InChI=1S/C25H27NO4S/c1-2-24(30-20-12-7-4-8-13-20)25(28)26-22(16-19-10-5-3-6-11-19)23(27)18-31-17-21-14-9-15-29-21/h3-15,22,24H,2,16-18H2,1H3,(H,26,28)/t22-,24?/m0/s1 |
| InChIKey | YOFGWTILFYEPRE-OWJIYDKWSA-N |
| XLogP | 4.67 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |