C16H25NO4S — CID 15287861
tert-butyl N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxohexan-3-yl]carbamate (PubChem CID 15287861) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 15287861 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | tert-butyl N-[(3S)-1-(furan-2-ylmethylsulfanyl)-2-oxohexan-3-yl]carbamate |
| SMILES | CCC[C@H](NC(=O)OC(C)(C)C)C(=O)CSCc1ccco1 |
| InChI | InChI=1S/C16H25NO4S/c1-5-7-13(17-15(19)21-16(2,3)4)14(18)11-22-10-12-8-6-9-20-12/h6,8-9,13H,5,7,10-11H2,1-4H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | PBDDOHSFGCETKG-ZDUSSCGKSA-N |
| XLogP | 3.78 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |