About tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate
tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 11523892) has the molecular formula C22H30N2O4
and a molecular weight of 386.49 g/mol. Its IUPAC name is tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate |
| PubChem CID | 11523892 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCc1cccc(CC)c1NC(=O)C(Cc1ccco1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N2O4/c1-6-15-10-8-11-16(7-2)19(15)24-20(25)18(14-17-12-9-13-27-17)23-21(26)28-22(3,4)5/h8-13,18H,6-7,14H2,1-5H3,(H,23,26)(H,24,25) |
| InChIKey | SCTAYBHCBIHKDP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate (CID 11523892) is tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate is CCc1cccc(CC)c1NC(=O)C(Cc1ccco1)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate?
The InChIKey is SCTAYBHCBIHKDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2O4/c1-6-15-10-8-11-16(7-2)19(15)24-20(25)18(14-17-12-9-13-27-17)23-21(26)28-22(3,4)5/h8-13,18H,6-7,14H2,1-5H3,(H,23,26)(H,24,25).
What are the key properties of tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate?
tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate has a molecular weight of 386.49 g/mol, XLogP of 4.48, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(2,6-diethylanilino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate is sourced from PubChem (CID 11523892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).