About tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate
tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 11552803) has the molecular formula C19H21N3O4S
and a molecular weight of 387.46 g/mol. Its IUPAC name is tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate |
| PubChem CID | 11552803 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccco1)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H21N3O4S/c1-19(2,3)26-18(24)21-14(11-12-7-6-10-25-12)16(23)22-17-20-13-8-4-5-9-15(13)27-17/h4-10,14H,11H2,1-3H3,(H,21,24)(H,20,22,23) |
| InChIKey | OIILZLKKEJFNSD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate (CID 11552803) is tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate is CC(C)(C)OC(=O)NC(Cc1ccco1)C(=O)Nc1nc2ccccc2s1.
What is the InChIKey of tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate?
The InChIKey is OIILZLKKEJFNSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4S/c1-19(2,3)26-18(24)21-14(11-12-7-6-10-25-12)16(23)22-17-20-13-8-4-5-9-15(13)27-17/h4-10,14H,11H2,1-3H3,(H,21,24)(H,20,22,23).
What are the key properties of tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate?
tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate has a molecular weight of 387.46 g/mol, XLogP of 3.96, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(1,3-benzothiazol-2-ylamino)-3-(furan-2-yl)-1-oxopropan-2-yl]carbamate is sourced from PubChem (CID 11552803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).