C18H18ClN3O4S — CID 11611194
2-[(2-chloroacetyl)amino]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(furan-2-yl)propanamide (PubChem CID 11611194) has the molecular formula C18H18ClN3O4S and a molecular weight of 407.88 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)amino]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(furan-2-yl)propanamide.
| Compound Name | 2-[(2-chloroacetyl)amino]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 11611194 |
| Molecular Formula | C18H18ClN3O4S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2-[(2-chloroacetyl)amino]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(furan-2-yl)propanamide |
| SMILES | CCOc1ccc2nc(NC(=O)C(Cc3ccco3)NC(=O)CCl)sc2c1 |
| InChI | InChI=1S/C18H18ClN3O4S/c1-2-25-12-5-6-13-15(9-12)27-18(21-13)22-17(24)14(20-16(23)10-19)8-11-4-3-7-26-11/h3-7,9,14H,2,8,10H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | VRHADSMVIGOMEM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|