C13H22N2O3 — CID 107237322
tert-butyl N-[4-(furan-2-yl)butan-2-ylamino]carbamate (PubChem CID 107237322) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl N-[4-(furan-2-yl)butan-2-ylamino]carbamate.
| Compound Name | tert-butyl N-[4-(furan-2-yl)butan-2-ylamino]carbamate |
|---|---|
| PubChem CID | 107237322 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | tert-butyl N-[4-(furan-2-yl)butan-2-ylamino]carbamate |
| SMILES | CC(CCc1ccco1)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22N2O3/c1-10(7-8-11-6-5-9-17-11)14-15-12(16)18-13(2,3)4/h5-6,9-10,14H,7-8H2,1-4H3,(H,15,16) |
| InChIKey | IHNYOXWSFVTMLR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|