C16H25NO4 — CID 106707217
tert-butyl 4-[4-(furan-2-yl)butan-2-ylamino]-4-oxobutanoate (PubChem CID 106707217) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl 4-[4-(furan-2-yl)butan-2-ylamino]-4-oxobutanoate.
| Compound Name | tert-butyl 4-[4-(furan-2-yl)butan-2-ylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 106707217 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | tert-butyl 4-[4-(furan-2-yl)butan-2-ylamino]-4-oxobutanoate |
| SMILES | CC(CCc1ccco1)NC(=O)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO4/c1-12(7-8-13-6-5-11-20-13)17-14(18)9-10-15(19)21-16(2,3)4/h5-6,11-12H,7-10H2,1-4H3,(H,17,18) |
| InChIKey | CITDPJBAMNONFY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |