C15H34N2O3Si — CID 58901310
tert-butyl N-[(2S,3R)-3-amino-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]carbamate (PubChem CID 58901310) has the molecular formula C15H34N2O3Si and a molecular weight of 318.53 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-amino-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-amino-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58901310 |
| Molecular Formula | C15H34N2O3Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-amino-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]carbamate |
| SMILES | C[C@@H](N)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H34N2O3Si/c1-11(16)12(17-13(18)20-14(2,3)4)10-19-21(8,9)15(5,6)7/h11-12H,10,16H2,1-9H3,(H,17,18)/t11-,12-/m1/s1 |
| InChIKey | ZOQKDPNJKGBEGM-VXGBXAGGSA-N |
| XLogP | 3.25 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|