C19H39NO4Si — CID 140693338
tert-butyl N-[(3R,4S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-methylhept-6-en-3-yl]carbamate (PubChem CID 140693338) has the molecular formula C19H39NO4Si and a molecular weight of 373.61 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-methylhept-6-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-methylhept-6-en-3-yl]carbamate |
|---|---|
| PubChem CID | 140693338 |
| Molecular Formula | C19H39NO4Si |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | tert-butyl N-[(3R,4S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-methylhept-6-en-3-yl]carbamate |
| SMILES | C=C[C@@H](C)[C@H](O)[C@@H](CCO[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H39NO4Si/c1-11-14(2)16(21)15(20-17(22)24-18(3,4)5)12-13-23-25(9,10)19(6,7)8/h11,14-16,21H,1,12-13H2,2-10H3,(H,20,22)/t14-,15-,16+/m1/s1 |
| InChIKey | CJEXMAYWKBJUPM-OAGGEKHMSA-N |
| XLogP | 4.47 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|