C18H38N2O3Si — CID 73056650
tert-butyl N-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(prop-2-enylamino)butan-2-yl]carbamate (PubChem CID 73056650) has the molecular formula C18H38N2O3Si and a molecular weight of 358.60 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(prop-2-enylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(prop-2-enylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 73056650 |
| Molecular Formula | C18H38N2O3Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | tert-butyl N-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-(prop-2-enylamino)butan-2-yl]carbamate |
| SMILES | C=CCNC[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38N2O3Si/c1-11-12-19-13-15(20-16(21)22-17(3,4)5)14(2)23-24(9,10)18(6,7)8/h11,14-15,19H,1,12-13H2,2-10H3,(H,20,21)/t14-,15-/m1/s1 |
| InChIKey | ZFNOZKPPVQMQPE-HUUCEWRRSA-N |
| XLogP | 4.07 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|