C16H31N3O4Si — CID 137302671
tert-butyl N-[(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-diazo-2-oxopentan-3-yl]carbamate (PubChem CID 137302671) has the molecular formula C16H31N3O4Si and a molecular weight of 357.53 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-diazo-2-oxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-diazo-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 137302671 |
| Molecular Formula | C16H31N3O4Si |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | tert-butyl N-[(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-diazo-2-oxopentan-3-yl]carbamate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](NC(=O)OC(C)(C)C)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C16H31N3O4Si/c1-11(23-24(8,9)16(5,6)7)13(12(20)10-18-17)19-14(21)22-15(2,3)4/h10-11,13H,1-9H3,(H,19,21)/t11-,13+/m1/s1 |
| InChIKey | RWGICRKMXPBNBU-YPMHNXCESA-N |
| XLogP | 3.16 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|