C10H17N3O3 — CID 101058178
tert-butyl N-[(2S)-5-diazo-4-oxopentan-2-yl]carbamate (PubChem CID 101058178) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-diazo-4-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-5-diazo-4-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 101058178 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | tert-butyl N-[(2S)-5-diazo-4-oxopentan-2-yl]carbamate |
| SMILES | C[C@@H](CC(=O)C=[N+]=[N-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17N3O3/c1-7(5-8(14)6-12-11)13-9(15)16-10(2,3)4/h6-7H,5H2,1-4H3,(H,13,15)/t7-/m0/s1 |
| InChIKey | TYPYMBVJXCVBPA-ZETCQYMHSA-N |
| XLogP | 1.16 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|