C10H22N2O2 — CID 71301755
tert-butyl N-[(2R)-1-(ethylamino)propan-2-yl]carbamate (PubChem CID 71301755) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(ethylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(ethylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 71301755 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | tert-butyl N-[(2R)-1-(ethylamino)propan-2-yl]carbamate |
| SMILES | CCNC[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H22N2O2/c1-6-11-7-8(2)12-9(13)14-10(3,4)5/h8,11H,6-7H2,1-5H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | VJRACYXJGFHJHI-MRVPVSSYSA-N |
| XLogP | 1.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |