C11H23ClN2O2 — CID 68943833
tert-butyl N-[(2S)-1-(cyclopropylamino)propan-2-yl]carbamate;hydrochloride (PubChem CID 68943833) has the molecular formula C11H23ClN2O2 and a molecular weight of 250.77 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(cyclopropylamino)propan-2-yl]carbamate;hydrochloride.
| Compound Name | tert-butyl N-[(2S)-1-(cyclopropylamino)propan-2-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 68943833 |
| Molecular Formula | C11H23ClN2O2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | tert-butyl N-[(2S)-1-(cyclopropylamino)propan-2-yl]carbamate;hydrochloride |
| SMILES | C[C@@H](CNC1CC1)NC(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C11H22N2O2.ClH/c1-8(7-12-9-5-6-9)13-10(14)15-11(2,3)4;/h8-9,12H,5-7H2,1-4H3,(H,13,14);1H/t8-;/m0./s1 |
| InChIKey | PWQJQOIWJZSHKP-QRPNPIFTSA-N |
| XLogP | 2.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |