C14H31N3O2 — CID 107442960
tert-butyl N-[1-[[2-(aminomethyl)-3-methylbutyl]amino]propan-2-yl]carbamate (PubChem CID 107442960) has the molecular formula C14H31N3O2 and a molecular weight of 273.42 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(aminomethyl)-3-methylbutyl]amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(aminomethyl)-3-methylbutyl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 107442960 |
| Molecular Formula | C14H31N3O2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.24 |
| IUPAC Name | tert-butyl N-[1-[[2-(aminomethyl)-3-methylbutyl]amino]propan-2-yl]carbamate |
| SMILES | CC(CNCC(CN)C(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H31N3O2/c1-10(2)12(7-15)9-16-8-11(3)17-13(18)19-14(4,5)6/h10-12,16H,7-9,15H2,1-6H3,(H,17,18) |
| InChIKey | WSCDBKQIWGGMCX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |