C9H19NO3S — CID 160711202
tert-butyl N-[(2S)-1-(sulfanylmethoxy)propan-2-yl]carbamate (PubChem CID 160711202) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(sulfanylmethoxy)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(sulfanylmethoxy)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 160711202 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | tert-butyl N-[(2S)-1-(sulfanylmethoxy)propan-2-yl]carbamate |
| SMILES | C[C@@H](COCS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H19NO3S/c1-7(5-12-6-14)10-8(11)13-9(2,3)4/h7,14H,5-6H2,1-4H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | VBSNDXCEECVYBH-ZETCQYMHSA-N |
| XLogP | 1.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|