C13H26N2O4 — CID 175605788
2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl N-tert-butylcarbamate (PubChem CID 175605788) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl N-tert-butylcarbamate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175605788 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl N-tert-butylcarbamate |
| SMILES | CC(COC(=O)NC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H26N2O4/c1-9(14-10(16)19-13(5,6)7)8-18-11(17)15-12(2,3)4/h9H,8H2,1-7H3,(H,14,16)(H,15,17) |
| InChIKey | PWQVBRMRUQHPHT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |