C9H19NO2S — CID 58618386
tert-butyl N-[(2R)-3,4-dideuterio-4-sulfanylbutan-2-yl]carbamate (PubChem CID 58618386) has the molecular formula C9H19NO2S and a molecular weight of 207.34 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3,4-dideuterio-4-sulfanylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3,4-dideuterio-4-sulfanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58618386 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | tert-butyl N-[(2R)-3,4-dideuterio-4-sulfanylbutan-2-yl]carbamate |
| SMILES | [2H]C(S)C([2H])[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H19NO2S/c1-7(5-6-13)10-8(11)12-9(2,3)4/h7,13H,5-6H2,1-4H3,(H,10,11)/t7-/m1/s1/i5D,6D/t5?,6?,7- |
| InChIKey | OERWQLISDJGWKJ-XOSOCEOQSA-N |
| XLogP | 2.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|