C11H21ClN2O2 — CID 130774480
tert-butyl N-[(2R)-1-(2-chloroprop-2-enylamino)propan-2-yl]carbamate (PubChem CID 130774480) has the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(2-chloroprop-2-enylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(2-chloroprop-2-enylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 130774480 |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | tert-butyl N-[(2R)-1-(2-chloroprop-2-enylamino)propan-2-yl]carbamate |
| SMILES | C=C(Cl)CNC[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21ClN2O2/c1-8(12)6-13-7-9(2)14-10(15)16-11(3,4)5/h9,13H,1,6-7H2,2-5H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | JIECBOAOZMTIQD-SECBINFHSA-N |
| XLogP | 2.24 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |