C12H21N3O3 — CID 3633983
tert-butyl N-(1-diazo-5-methyl-2-oxohexan-3-yl)carbamate (PubChem CID 3633983) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is tert-butyl N-(1-diazo-5-methyl-2-oxohexan-3-yl)carbamate.
| Compound Name | tert-butyl N-(1-diazo-5-methyl-2-oxohexan-3-yl)carbamate |
|---|---|
| PubChem CID | 3633983 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | tert-butyl N-(1-diazo-5-methyl-2-oxohexan-3-yl)carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C12H21N3O3/c1-8(2)6-9(10(16)7-14-13)15-11(17)18-12(3,4)5/h7-9H,6H2,1-5H3,(H,15,17) |
| InChIKey | ZECQFLSUODDBDO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|