C17H36N4O3Si — CID 123156364
tert-butyl N-[(2R,3R,4S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-2-yl]carbamate (PubChem CID 123156364) has the molecular formula C17H36N4O3Si and a molecular weight of 372.59 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,4S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,4S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 123156364 |
| Molecular Formula | C17H36N4O3Si |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | tert-butyl N-[(2R,3R,4S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentan-2-yl]carbamate |
| SMILES | C[C@@H](CN=[N+]=[N-])[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H36N4O3Si/c1-12(11-19-21-18)14(24-25(9,10)17(6,7)8)13(2)20-15(22)23-16(3,4)5/h12-14H,11H2,1-10H3,(H,20,22)/t12-,13+,14+/m0/s1 |
| InChIKey | YIPHDZCULOTWNV-BFHYXJOUSA-N |
| XLogP | 5.24 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|