C11H19FN4O4 — CID 91233728
(3R,5R)-6-azido-5-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 91233728) has the molecular formula C11H19FN4O4 and a molecular weight of 290.30 g/mol. Its IUPAC name is (3R,5R)-6-azido-5-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (3R,5R)-6-azido-5-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 91233728 |
| Molecular Formula | C11H19FN4O4 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (3R,5R)-6-azido-5-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C[C@@H](F)CN=[N+]=[N-] |
| InChI | InChI=1S/C11H19FN4O4/c1-11(2,3)20-10(19)15-8(5-9(17)18)4-7(12)6-14-16-13/h7-8H,4-6H2,1-3H3,(H,15,19)(H,17,18)/t7-,8+/m1/s1 |
| InChIKey | QPXAFNGHHOIIIU-SFYZADRCSA-N |
| XLogP | 2.39 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|