C22H41N9O8 — CID 155257760
tert-butyl N-[1,5-bis[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1,5-dioxopentan-3-yl]carbamate (PubChem CID 155257760) has the molecular formula C22H41N9O8 and a molecular weight of 559.63 g/mol. Its IUPAC name is tert-butyl N-[1,5-bis[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1,5-dioxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1,5-bis[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1,5-dioxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 155257760 |
| Molecular Formula | C22H41N9O8 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | tert-butyl N-[1,5-bis[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-1,5-dioxopentan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)NCCOCCOCCN=[N+]=[N-])CC(=O)NCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C22H41N9O8/c1-22(2,3)39-21(34)29-18(16-19(32)25-4-8-35-12-14-37-10-6-27-30-23)17-20(33)26-5-9-36-13-15-38-11-7-28-31-24/h18H,4-17H2,1-3H3,(H,25,32)(H,26,33)(H,29,34) |
| InChIKey | NDWGMBHZBOTYJH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 230.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|