C14H25FN4O4 — CID 166000415
tert-butyl (2S,4S)-5-azido-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 166000415) has the molecular formula C14H25FN4O4 and a molecular weight of 332.38 g/mol. Its IUPAC name is tert-butyl (2S,4S)-5-azido-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | tert-butyl (2S,4S)-5-azido-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 166000415 |
| Molecular Formula | C14H25FN4O4 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | tert-butyl (2S,4S)-5-azido-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@H](F)CN=[N+]=[N-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25FN4O4/c1-13(2,3)22-11(20)10(7-9(15)8-17-19-16)18-12(21)23-14(4,5)6/h9-10H,7-8H2,1-6H3,(H,18,21)/t9-,10-/m0/s1 |
| InChIKey | KVHPLNIYOJMNJS-UWVGGRQHSA-N |
| XLogP | 3.26 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|