C9H13FN4O4 — CID 167736120
(2S,4R)-5-azido-4-fluoro-2-(prop-2-enoxycarbonylamino)pentanoic acid (PubChem CID 167736120) has the molecular formula C9H13FN4O4 and a molecular weight of 260.23 g/mol. Its IUPAC name is (2S,4R)-5-azido-4-fluoro-2-(prop-2-enoxycarbonylamino)pentanoic acid.
| Compound Name | (2S,4R)-5-azido-4-fluoro-2-(prop-2-enoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 167736120 |
| Molecular Formula | C9H13FN4O4 |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | (2S,4R)-5-azido-4-fluoro-2-(prop-2-enoxycarbonylamino)pentanoic acid |
| SMILES | C=CCOC(=O)N[C@@H](C[C@@H](F)CN=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C9H13FN4O4/c1-2-3-18-9(17)13-7(8(15)16)4-6(10)5-12-14-11/h2,6-7H,1,3-5H2,(H,13,17)(H,15,16)/t6-,7+/m1/s1 |
| InChIKey | MTNFMSOVWJVKFO-RQJHMYQMSA-N |
| XLogP | 1.39 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|