C14H18N4O5 — CID 23244641
(2S,5R)-6-azido-5-hydroxy-2-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 23244641) has the molecular formula C14H18N4O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is (2S,5R)-6-azido-5-hydroxy-2-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S,5R)-6-azido-5-hydroxy-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 23244641 |
| Molecular Formula | C14H18N4O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (2S,5R)-6-azido-5-hydroxy-2-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | [N-]=[N+]=NC[C@H](O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H18N4O5/c15-18-16-8-11(19)6-7-12(13(20)21)17-14(22)23-9-10-4-2-1-3-5-10/h1-5,11-12,19H,6-9H2,(H,17,22)(H,20,21)/t11-,12+/m1/s1 |
| InChIKey | VDYWDSMEIZXJRC-NEPJUHHUSA-N |
| XLogP | 1.82 |
| TPSA | 144.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|