C12H14N4O5 — CID 170169833
(2S)-4-azido-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 170169833) has the molecular formula C12H14N4O5 and a molecular weight of 294.27 g/mol. Its IUPAC name is (2S)-4-azido-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-4-azido-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 170169833 |
| Molecular Formula | C12H14N4O5 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2S)-4-azido-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | [N-]=[N+]=NCC(O)[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H14N4O5/c13-16-14-6-9(17)10(11(18)19)15-12(20)21-7-8-4-2-1-3-5-8/h1-5,9-10,17H,6-7H2,(H,15,20)(H,18,19)/t9?,10-/m0/s1 |
| InChIKey | ADJFEHAYBUXGFD-AXDSSHIGSA-N |
| XLogP | 1.04 |
| TPSA | 144.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|