C20H21BrN4O5 — CID 101072286
(4-bromophenyl) (2S,3R)-6-azido-3-hydroxy-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 101072286) has the molecular formula C20H21BrN4O5 and a molecular weight of 477.32 g/mol. Its IUPAC name is (4-bromophenyl) (2S,3R)-6-azido-3-hydroxy-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | (4-bromophenyl) (2S,3R)-6-azido-3-hydroxy-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 101072286 |
| Molecular Formula | C20H21BrN4O5 |
| Molecular Weight | 477.32 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | (4-bromophenyl) (2S,3R)-6-azido-3-hydroxy-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | [N-]=[N+]=NCCC[C@@H](O)[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H21BrN4O5/c21-15-8-10-16(11-9-15)30-19(27)18(17(26)7-4-12-23-25-22)24-20(28)29-13-14-5-2-1-3-6-14/h1-3,5-6,8-11,17-18,26H,4,7,12-13H2,(H,24,28)/t17-,18+/m1/s1 |
| InChIKey | MZGLMPCGEKROEE-MSOLQXFVSA-N |
| XLogP | 4.10 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|