C24H36N6O8 — CID 146789670
benzyl N-[(4S)-1-amino-8-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-1,5,8-trioxooctan-4-yl]carbamate (PubChem CID 146789670) has the molecular formula C24H36N6O8 and a molecular weight of 536.59 g/mol. Its IUPAC name is benzyl N-[(4S)-1-amino-8-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-1,5,8-trioxooctan-4-yl]carbamate.
| Compound Name | benzyl N-[(4S)-1-amino-8-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-1,5,8-trioxooctan-4-yl]carbamate |
|---|---|
| PubChem CID | 146789670 |
| Molecular Formula | C24H36N6O8 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | benzyl N-[(4S)-1-amino-8-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-1,5,8-trioxooctan-4-yl]carbamate |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNC(=O)CCC(=O)[C@H](CCC(N)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H36N6O8/c25-22(32)8-6-20(29-24(34)38-18-19-4-2-1-3-5-19)21(31)7-9-23(33)27-10-12-35-14-16-37-17-15-36-13-11-28-30-26/h1-5,20H,6-18H2,(H2,25,32)(H,27,33)(H,29,34)/t20-/m0/s1 |
| InChIKey | RVOIVNTXVXAUEH-FQEVSTJZSA-N |
| XLogP | 1.37 |
| TPSA | 204.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|