C26H25N5O8 — CID 135209766
dibenzyl 1-[2-[2-(2-azidoethoxy)ethylamino]-2-oxoethyl]-2,5-dioxopyrrole-3,4-dicarboxylate (PubChem CID 135209766) has the molecular formula C26H25N5O8 and a molecular weight of 535.51 g/mol. Its IUPAC name is dibenzyl 1-[2-[2-(2-azidoethoxy)ethylamino]-2-oxoethyl]-2,5-dioxopyrrole-3,4-dicarboxylate.
| Compound Name | dibenzyl 1-[2-[2-(2-azidoethoxy)ethylamino]-2-oxoethyl]-2,5-dioxopyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 135209766 |
| Molecular Formula | C26H25N5O8 |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | dibenzyl 1-[2-[2-(2-azidoethoxy)ethylamino]-2-oxoethyl]-2,5-dioxopyrrole-3,4-dicarboxylate |
| SMILES | [N-]=[N+]=NCCOCCNC(=O)CN1C(=O)C(C(=O)OCc2ccccc2)=C(C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H25N5O8/c27-30-29-12-14-37-13-11-28-20(32)15-31-23(33)21(25(35)38-16-18-7-3-1-4-8-18)22(24(31)34)26(36)39-17-19-9-5-2-6-10-19/h1-10H,11-17H2,(H,28,32) |
| InChIKey | CXVPRDWGUCEBRD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 177.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|