C27H40N8O8 — CID 59561930
benzyl (3S)-3-acetamido-4-[[(2S)-1-[2-(2-azidoethoxy)ethylamino]-4-(2-morpholin-4-ylethylamino)-1,4-dioxobutan-2-yl]amino]-4-oxobutanoate (PubChem CID 59561930) has the molecular formula C27H40N8O8 and a molecular weight of 604.67 g/mol. Its IUPAC name is benzyl (3S)-3-acetamido-4-[[(2S)-1-[2-(2-azidoethoxy)ethylamino]-4-(2-morpholin-4-ylethylamino)-1,4-dioxobutan-2-yl]amino]-4-oxobutanoate.
| Compound Name | benzyl (3S)-3-acetamido-4-[[(2S)-1-[2-(2-azidoethoxy)ethylamino]-4-(2-morpholin-4-ylethylamino)-1,4-dioxobutan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 59561930 |
| Molecular Formula | C27H40N8O8 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | benzyl (3S)-3-acetamido-4-[[(2S)-1-[2-(2-azidoethoxy)ethylamino]-4-(2-morpholin-4-ylethylamino)-1,4-dioxobutan-2-yl]amino]-4-oxobutanoate |
| SMILES | CC(=O)N[C@@H](CC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(=O)NCCN1CCOCC1)C(=O)NCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C27H40N8O8/c1-20(36)32-23(18-25(38)43-19-21-5-3-2-4-6-21)27(40)33-22(26(39)30-8-13-41-14-9-31-34-28)17-24(37)29-7-10-35-11-15-42-16-12-35/h2-6,22-23H,7-19H2,1H3,(H,29,37)(H,30,39)(H,32,36)(H,33,40)/t22-,23-/m0/s1 |
| InChIKey | ONRANQZCVIHJMM-GOTSBHOMSA-N |
| XLogP | -0.61 |
| TPSA | 213.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|