C26H48N12O6 — CID 59561991
(2R)-2-acetamido-N-[(2S)-1-[2-(2-azidoethoxy)ethylamino]-1,4-dioxo-4-(2-piperazin-1-ylethylamino)butan-2-yl]-N'-(2-piperazin-1-ylethyl)butanediamide (PubChem CID 59561991) has the molecular formula C26H48N12O6 and a molecular weight of 624.75 g/mol. Its IUPAC name is (2R)-2-acetamido-N-[(2S)-1-[2-(2-azidoethoxy)ethylamino]-1,4-dioxo-4-(2-piperazin-1-ylethylamino)butan-2-yl]-N'-(2-piperazin-1-ylethyl)butanediamide.
| Compound Name | (2R)-2-acetamido-N-[(2S)-1-[2-(2-azidoethoxy)ethylamino]-1,4-dioxo-4-(2-piperazin-1-ylethylamino)butan-2-yl]-N'-(2-piperazin-1-ylethyl)butanediamide |
|---|---|
| PubChem CID | 59561991 |
| Molecular Formula | C26H48N12O6 |
| Molecular Weight | 624.75 g/mol |
| Exact Mass | 624.38 |
| IUPAC Name | (2R)-2-acetamido-N-[(2S)-1-[2-(2-azidoethoxy)ethylamino]-1,4-dioxo-4-(2-piperazin-1-ylethylamino)butan-2-yl]-N'-(2-piperazin-1-ylethyl)butanediamide |
| SMILES | CC(=O)N[C@H](CC(=O)NCCN1CCNCC1)C(=O)N[C@@H](CC(=O)NCCN1CCNCC1)C(=O)NCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C26H48N12O6/c1-20(39)34-22(19-24(41)31-7-15-38-12-4-29-5-13-38)26(43)35-21(25(42)32-8-16-44-17-9-33-36-27)18-23(40)30-6-14-37-10-2-28-3-11-37/h21-22,28-29H,2-19H2,1H3,(H,30,40)(H,31,41)(H,32,42)(H,34,39)(H,35,43)/t21-,22+/m0/s1 |
| InChIKey | NFRPPBJYJJOREA-FCHUYYIVSA-N |
| XLogP | -3.76 |
| TPSA | 234.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.75 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|