C22H46N12O6+2 — CID 59561914
2-[2-[[(3R)-3-acetamido-4-[[(2S)-4-[2-(2-azaniumylethylamino)ethylamino]-1-[2-(2-azidoethoxy)ethylamino]-1,4-dioxobutan-2-yl]amino]-4-oxobutanoyl]amino]ethylamino]ethylazanium (PubChem CID 59561914) has the molecular formula C22H46N12O6+2 and a molecular weight of 574.69 g/mol. Its IUPAC name is 2-[2-[[(3R)-3-acetamido-4-[[(2S)-4-[2-(2-azaniumylethylamino)ethylamino]-1-[2-(2-azidoethoxy)ethylamino]-1,4-dioxobutan-2-yl]amino]-4-oxobutanoyl]amino]ethylamino]ethylazanium.
| Compound Name | 2-[2-[[(3R)-3-acetamido-4-[[(2S)-4-[2-(2-azaniumylethylamino)ethylamino]-1-[2-(2-azidoethoxy)ethylamino]-1,4-dioxobutan-2-yl]amino]-4-oxobutanoyl]amino]ethylamino]ethylazanium |
|---|---|
| PubChem CID | 59561914 |
| Molecular Formula | C22H46N12O6+2 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.37 |
| IUPAC Name | 2-[2-[[(3R)-3-acetamido-4-[[(2S)-4-[2-(2-azaniumylethylamino)ethylamino]-1-[2-(2-azidoethoxy)ethylamino]-1,4-dioxobutan-2-yl]amino]-4-oxobutanoyl]amino]ethylamino]ethylazanium |
| SMILES | CC(=O)N[C@H](CC(=O)NCCNCC[NH3+])C(=O)N[C@@H](CC(=O)NCCNCC[NH3+])C(=O)NCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C22H44N12O6/c1-16(35)32-18(15-20(37)29-9-7-27-5-3-24)22(39)33-17(14-19(36)28-8-6-26-4-2-23)21(38)30-10-12-40-13-11-31-34-25/h17-18,26-27H,2-15,23-24H2,1H3,(H,28,36)(H,29,37)(H,30,38)(H,32,35)(H,33,39)/p+2/t17-,18+/m0/s1 |
| InChIKey | BRYHSYGLBKYRDI-ZWKOTPCHSA-P |
| XLogP | -5.91 |
| TPSA | 282.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | -5.91 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|