C22H43N9O6 — CID 59561939
(2S)-2-acetamido-N'-[2-(2-aminoethylamino)ethyl]-N-[(2R)-1-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-4-methyl-1-oxopentan-2-yl]butanediamide (PubChem CID 59561939) has the molecular formula C22H43N9O6 and a molecular weight of 529.64 g/mol. Its IUPAC name is (2S)-2-acetamido-N'-[2-(2-aminoethylamino)ethyl]-N-[(2R)-1-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-4-methyl-1-oxopentan-2-yl]butanediamide.
| Compound Name | (2S)-2-acetamido-N'-[2-(2-aminoethylamino)ethyl]-N-[(2R)-1-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-4-methyl-1-oxopentan-2-yl]butanediamide |
|---|---|
| PubChem CID | 59561939 |
| Molecular Formula | C22H43N9O6 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | (2S)-2-acetamido-N'-[2-(2-aminoethylamino)ethyl]-N-[(2R)-1-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-4-methyl-1-oxopentan-2-yl]butanediamide |
| SMILES | CC(=O)N[C@@H](CC(=O)NCCNCCN)C(=O)N[C@H](CC(C)C)C(=O)NCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C22H43N9O6/c1-16(2)14-18(21(34)27-8-10-36-12-13-37-11-9-28-31-24)30-22(35)19(29-17(3)32)15-20(33)26-7-6-25-5-4-23/h16,18-19,25H,4-15,23H2,1-3H3,(H,26,33)(H,27,34)(H,29,32)(H,30,35)/t18-,19+/m1/s1 |
| InChIKey | SSFAQVJYEGAVBM-MOPGFXCFSA-N |
| XLogP | -1.46 |
| TPSA | 221.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|