C21H40N8O5 — CID 161054073
(2S)-2-[(3R)-3-acetamido-5-methyl-2-oxohexyl]-N'-[2-(2-aminoethylamino)ethyl]-N-[2-(2-azidoethoxy)ethyl]butanediamide (PubChem CID 161054073) has the molecular formula C21H40N8O5 and a molecular weight of 484.60 g/mol. Its IUPAC name is (2S)-2-[(3R)-3-acetamido-5-methyl-2-oxohexyl]-N'-[2-(2-aminoethylamino)ethyl]-N-[2-(2-azidoethoxy)ethyl]butanediamide.
| Compound Name | (2S)-2-[(3R)-3-acetamido-5-methyl-2-oxohexyl]-N'-[2-(2-aminoethylamino)ethyl]-N-[2-(2-azidoethoxy)ethyl]butanediamide |
|---|---|
| PubChem CID | 161054073 |
| Molecular Formula | C21H40N8O5 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | (2S)-2-[(3R)-3-acetamido-5-methyl-2-oxohexyl]-N'-[2-(2-aminoethylamino)ethyl]-N-[2-(2-azidoethoxy)ethyl]butanediamide |
| SMILES | CC(=O)N[C@H](CC(C)C)C(=O)C[C@@H](CC(=O)NCCNCCN)C(=O)NCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C21H40N8O5/c1-15(2)12-18(28-16(3)30)19(31)13-17(14-20(32)25-7-6-24-5-4-22)21(33)26-8-10-34-11-9-27-29-23/h15,17-18,24H,4-14,22H2,1-3H3,(H,25,32)(H,26,33)(H,28,30)/t17-,18+/m0/s1 |
| InChIKey | QAHBFPKDFHBTLQ-ZWKOTPCHSA-N |
| XLogP | -0.39 |
| TPSA | 200.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|