C24H45N11O7 — CID 59561986
(2S)-2-acetamido-N'-[2-(2-aminoethylamino)ethyl]-N-[(2S)-1-[2-(2-azidoethoxy)ethylamino]-4-(2-morpholin-4-ylethylamino)-1,4-dioxobutan-2-yl]butanediamide (PubChem CID 59561986) has the molecular formula C24H45N11O7 and a molecular weight of 599.69 g/mol. Its IUPAC name is (2S)-2-acetamido-N'-[2-(2-aminoethylamino)ethyl]-N-[(2S)-1-[2-(2-azidoethoxy)ethylamino]-4-(2-morpholin-4-ylethylamino)-1,4-dioxobutan-2-yl]butanediamide.
| Compound Name | (2S)-2-acetamido-N'-[2-(2-aminoethylamino)ethyl]-N-[(2S)-1-[2-(2-azidoethoxy)ethylamino]-4-(2-morpholin-4-ylethylamino)-1,4-dioxobutan-2-yl]butanediamide |
|---|---|
| PubChem CID | 59561986 |
| Molecular Formula | C24H45N11O7 |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.35 |
| IUPAC Name | (2S)-2-acetamido-N'-[2-(2-aminoethylamino)ethyl]-N-[(2S)-1-[2-(2-azidoethoxy)ethylamino]-4-(2-morpholin-4-ylethylamino)-1,4-dioxobutan-2-yl]butanediamide |
| SMILES | CC(=O)N[C@@H](CC(=O)NCCNCCN)C(=O)N[C@@H](CC(=O)NCCN1CCOCC1)C(=O)NCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C24H45N11O7/c1-18(36)32-20(17-21(37)28-5-4-27-3-2-25)24(40)33-19(23(39)30-7-12-41-13-8-31-34-26)16-22(38)29-6-9-35-10-14-42-15-11-35/h19-20,27H,2-17,25H2,1H3,(H,28,37)(H,29,38)(H,30,39)(H,32,36)(H,33,40)/t19-,20-/m0/s1 |
| InChIKey | GWXIFEZACURHKU-PMACEKPBSA-N |
| XLogP | -3.69 |
| TPSA | 254.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|