C26H39N7O7 — CID 58300579
(2S)-N-[2-(2-azidoethoxy)ethyl]-2-[[(2R)-2-[[(2R)-2-[(4-hydroxyphenyl)methyl]-4-oxopentanoyl]amino]-4-methylpentanoyl]amino]butanediamide (PubChem CID 58300579) has the molecular formula C26H39N7O7 and a molecular weight of 561.64 g/mol. Its IUPAC name is (2S)-N-[2-(2-azidoethoxy)ethyl]-2-[[(2R)-2-[[(2R)-2-[(4-hydroxyphenyl)methyl]-4-oxopentanoyl]amino]-4-methylpentanoyl]amino]butanediamide.
| Compound Name | (2S)-N-[2-(2-azidoethoxy)ethyl]-2-[[(2R)-2-[[(2R)-2-[(4-hydroxyphenyl)methyl]-4-oxopentanoyl]amino]-4-methylpentanoyl]amino]butanediamide |
|---|---|
| PubChem CID | 58300579 |
| Molecular Formula | C26H39N7O7 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | (2S)-N-[2-(2-azidoethoxy)ethyl]-2-[[(2R)-2-[[(2R)-2-[(4-hydroxyphenyl)methyl]-4-oxopentanoyl]amino]-4-methylpentanoyl]amino]butanediamide |
| SMILES | CC(=O)C[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)NCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C26H39N7O7/c1-16(2)12-21(31-24(37)19(13-17(3)34)14-18-4-6-20(35)7-5-18)26(39)32-22(15-23(27)36)25(38)29-8-10-40-11-9-30-33-28/h4-7,16,19,21-22,35H,8-15H2,1-3H3,(H2,27,36)(H,29,38)(H,31,37)(H,32,39)/t19-,21+,22-/m0/s1 |
| InChIKey | NEXFMIVNGLNZPM-NNWRFLSQSA-N |
| XLogP | 0.86 |
| TPSA | 225.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|