C38H52N4O13 — CID 132582739
ethyl 5-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]-3-oxo-1-phenylindene-2-carboxylate (PubChem CID 132582739) has the molecular formula C38H52N4O13 and a molecular weight of 772.85 g/mol. Its IUPAC name is ethyl 5-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]-3-oxo-1-phenylindene-2-carboxylate.
| Compound Name | ethyl 5-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]-3-oxo-1-phenylindene-2-carboxylate |
|---|---|
| PubChem CID | 132582739 |
| Molecular Formula | C38H52N4O13 |
| Molecular Weight | 772.85 g/mol |
| Exact Mass | 772.35 |
| IUPAC Name | ethyl 5-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethoxy]-3-oxo-1-phenylindene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)c2ccc(OCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])cc2C1=O |
| InChI | InChI=1S/C38H52N4O13/c1-2-54-38(45)36-35(30-6-4-3-5-7-30)32-9-8-31(28-33(32)37(36)44)55-29-34(43)40-10-12-46-14-16-48-18-20-50-22-24-52-26-27-53-25-23-51-21-19-49-17-15-47-13-11-41-42-39/h3-9,28H,2,10-27,29H2,1H3,(H,40,43) |
| InChIKey | VSZJEONMXWRACU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 204.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|