C22H27N3O5 — CID 55936544
benzyl N-[(2S)-5-amino-1-[2-(4-methylphenoxy)ethylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 55936544) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is benzyl N-[(2S)-5-amino-1-[2-(4-methylphenoxy)ethylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-amino-1-[2-(4-methylphenoxy)ethylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 55936544 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | benzyl N-[(2S)-5-amino-1-[2-(4-methylphenoxy)ethylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | Cc1ccc(OCCNC(=O)[C@H](CCC(N)=O)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H27N3O5/c1-16-7-9-18(10-8-16)29-14-13-24-21(27)19(11-12-20(23)26)25-22(28)30-15-17-5-3-2-4-6-17/h2-10,19H,11-15H2,1H3,(H2,23,26)(H,24,27)(H,25,28)/t19-/m0/s1 |
| InChIKey | VICMOPPDDXDVCW-IBGZPJMESA-N |
| XLogP | 2.05 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|