C15H18N6O5 — CID 175701089
benzyl N-[(2S)-5-amino-1-[(2-azido-2-oxoethyl)amino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 175701089) has the molecular formula C15H18N6O5 and a molecular weight of 362.35 g/mol. Its IUPAC name is benzyl N-[(2S)-5-amino-1-[(2-azido-2-oxoethyl)amino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-amino-1-[(2-azido-2-oxoethyl)amino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 175701089 |
| Molecular Formula | C15H18N6O5 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | benzyl N-[(2S)-5-amino-1-[(2-azido-2-oxoethyl)amino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | [N-]=[N+]=NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H18N6O5/c16-12(22)7-6-11(14(24)18-8-13(23)20-21-17)19-15(25)26-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H2,16,22)(H,18,24)(H,19,25)/t11-/m0/s1 |
| InChIKey | ZOCADGMKAYJCPN-NSHDSACASA-N |
| XLogP | 0.50 |
| TPSA | 176.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|