C16H18N4O6 — CID 11624715
2-[[(2S)-6-diazonio-5-oxo-2-(phenylmethoxycarbonylamino)hexanoyl]amino]acetate (PubChem CID 11624715) has the molecular formula C16H18N4O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is 2-[[(2S)-6-diazonio-5-oxo-2-(phenylmethoxycarbonylamino)hexanoyl]amino]acetate.
| Compound Name | 2-[[(2S)-6-diazonio-5-oxo-2-(phenylmethoxycarbonylamino)hexanoyl]amino]acetate |
|---|---|
| PubChem CID | 11624715 |
| Molecular Formula | C16H18N4O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2-[[(2S)-6-diazonio-5-oxo-2-(phenylmethoxycarbonylamino)hexanoyl]amino]acetate |
| SMILES | N#[N+]CC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C16H18N4O6/c17-19-8-12(21)6-7-13(15(24)18-9-14(22)23)20-16(25)26-10-11-4-2-1-3-5-11/h1-5,13H,6-10H2,(H2-,18,20,22,23,24,25)/t13-/m0/s1 |
| InChIKey | LTADXZMTEXGVDO-ZDUSSCGKSA-N |
| XLogP | -0.65 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|