C29H30N2O6 — CID 155884642
benzyl 4-oxo-5-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate (PubChem CID 155884642) has the molecular formula C29H30N2O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is benzyl 4-oxo-5-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate.
| Compound Name | benzyl 4-oxo-5-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 155884642 |
| Molecular Formula | C29H30N2O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | benzyl 4-oxo-5-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate |
| SMILES | O=C(CCC(=O)OCc1ccccc1)CNC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H30N2O6/c32-25(16-17-27(33)36-20-23-12-6-2-7-13-23)19-30-28(34)26(18-22-10-4-1-5-11-22)31-29(35)37-21-24-14-8-3-9-15-24/h1-15,26H,16-21H2,(H,30,34)(H,31,35) |
| InChIKey | GMVRKYBBLZHTBC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |